C14H11Br2NO2S — CID 107037079
N-(2,4-dibromo-5-methoxyphenyl)-3-sulfanylbenzamide (PubChem CID 107037079) has the molecular formula C14H11Br2NO2S and a molecular weight of 417.12 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-3-sulfanylbenzamide.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107037079 |
| Molecular Formula | C14H11Br2NO2S |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.89 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-3-sulfanylbenzamide |
| SMILES | COc1cc(NC(=O)c2cccc(S)c2)c(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2NO2S/c1-19-13-7-12(10(15)6-11(13)16)17-14(18)8-3-2-4-9(20)5-8/h2-7,20H,1H3,(H,17,18) |
| InChIKey | KMBNRHMDAUEBGE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|