C14H11Br2NO3 — CID 103414718
N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide (PubChem CID 103414718) has the molecular formula C14H11Br2NO3 and a molecular weight of 401.05 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 103414718 |
| Molecular Formula | C14H11Br2NO3 |
| Molecular Weight | 401.05 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2O)c(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2NO3/c1-20-13-7-11(9(15)6-10(13)16)17-14(19)8-4-2-3-5-12(8)18/h2-7,18H,1H3,(H,17,19) |
| InChIKey | SLSOZWVRYJXNBV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.05 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |