C16H11NO5-2 — CID 9326527
3-[(2-carboxylatobenzoyl)amino]-2-methylbenzoate (PubChem CID 9326527) has the molecular formula C16H11NO5-2 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-[(2-carboxylatobenzoyl)amino]-2-methylbenzoate.
| Compound Name | 3-[(2-carboxylatobenzoyl)amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 9326527 |
| Molecular Formula | C16H11NO5-2 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-[(2-carboxylatobenzoyl)amino]-2-methylbenzoate |
| SMILES | Cc1c(NC(=O)c2ccccc2C(=O)[O-])cccc1C(=O)[O-] |
| InChI | InChI=1S/C16H13NO5/c1-9-10(15(19)20)7-4-8-13(9)17-14(18)11-5-2-3-6-12(11)16(21)22/h2-8H,1H3,(H,17,18)(H,19,20)(H,21,22)/p-2 |
| InChIKey | QZPUGHFDCWSYPI-UHFFFAOYSA-L |
| XLogP | -0.03 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |