C13H10NO4- — CID 2225644
2-[(2-methylfuran-3-carbonyl)amino]benzoate (PubChem CID 2225644) has the molecular formula C13H10NO4- and a molecular weight of 244.23 g/mol. Its IUPAC name is 2-[(2-methylfuran-3-carbonyl)amino]benzoate.
| Compound Name | 2-[(2-methylfuran-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 2225644 |
| Molecular Formula | C13H10NO4- |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-[(2-methylfuran-3-carbonyl)amino]benzoate |
| SMILES | Cc1occc1C(=O)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C13H11NO4/c1-8-9(6-7-18-8)12(15)14-11-5-3-2-4-10(11)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | MDRZZFBPVFJTIQ-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |