C23H22N2O2 — CID 18207871
N-(4-acetylphenyl)-2-(2,3-dimethylanilino)benzamide (PubChem CID 18207871) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(2,3-dimethylanilino)benzamide.
| Compound Name | N-(4-acetylphenyl)-2-(2,3-dimethylanilino)benzamide |
|---|---|
| PubChem CID | 18207871 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-(4-acetylphenyl)-2-(2,3-dimethylanilino)benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccccc2Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C23H22N2O2/c1-15-7-6-10-21(16(15)2)25-22-9-5-4-8-20(22)23(27)24-19-13-11-18(12-14-19)17(3)26/h4-14,25H,1-3H3,(H,24,27) |
| InChIKey | XXBNVCTWLTZQAD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |