C15H14ClNO — CID 71393538
4-(2,3-dimethylanilino)benzoyl chloride (PubChem CID 71393538) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is 4-(2,3-dimethylanilino)benzoyl chloride.
| Compound Name | 4-(2,3-dimethylanilino)benzoyl chloride |
|---|---|
| PubChem CID | 71393538 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(2,3-dimethylanilino)benzoyl chloride |
| SMILES | Cc1cccc(Nc2ccc(C(=O)Cl)cc2)c1C |
| InChI | InChI=1S/C15H14ClNO/c1-10-4-3-5-14(11(10)2)17-13-8-6-12(7-9-13)15(16)18/h3-9,17H,1-2H3 |
| InChIKey | PGKGATGFGBQABF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|