C14H9O4- — CID 7022485
2-(1,3-benzodioxol-5-yl)benzoate (PubChem CID 7022485) has the molecular formula C14H9O4- and a molecular weight of 241.22 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)benzoate.
| Compound Name | 2-(1,3-benzodioxol-5-yl)benzoate |
|---|---|
| PubChem CID | 7022485 |
| Molecular Formula | C14H9O4- |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)benzoate |
| SMILES | O=C([O-])c1ccccc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H10O4/c15-14(16)11-4-2-1-3-10(11)9-5-6-12-13(7-9)18-8-17-12/h1-7H,8H2,(H,15,16)/p-1 |
| InChIKey | PEOCCFXRLGYKBM-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |