C22H14F6O3 — CID 46179560
2-[4-[2-(1,3-benzodioxol-5-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 46179560) has the molecular formula C22H14F6O3 and a molecular weight of 440.34 g/mol. Its IUPAC name is 2-[4-[2-(1,3-benzodioxol-5-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[2-(1,3-benzodioxol-5-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 46179560 |
| Molecular Formula | C22H14F6O3 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[4-[2-(1,3-benzodioxol-5-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(-c2ccccc2-c2ccc3c(c2)OCO3)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H14F6O3/c23-21(24,25)20(29,22(26,27)28)15-8-5-13(6-9-15)16-3-1-2-4-17(16)14-7-10-18-19(11-14)31-12-30-18/h1-11,29H,12H2 |
| InChIKey | NUAQFNYWEIBQRX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |