C13H9N2O2+ — CID 134879950
2-(1,3-benzodioxol-5-yl)benzenediazonium (PubChem CID 134879950) has the molecular formula C13H9N2O2+ and a molecular weight of 225.23 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)benzenediazonium.
| Compound Name | 2-(1,3-benzodioxol-5-yl)benzenediazonium |
|---|---|
| PubChem CID | 134879950 |
| Molecular Formula | C13H9N2O2+ |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)benzenediazonium |
| SMILES | N#[N+]c1ccccc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H9N2O2/c14-15-11-4-2-1-3-10(11)9-5-6-12-13(7-9)17-8-16-12/h1-7H,8H2/q+1 |
| InChIKey | DUMDVXKMLHYQSI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|