C21H12BrN3O2 — CID 5344235
2-amino-4-(1,3-benzodioxol-5-yl)-6-(4-bromophenyl)benzene-1,3-dicarbonitrile (PubChem CID 5344235) has the molecular formula C21H12BrN3O2 and a molecular weight of 418.25 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzodioxol-5-yl)-6-(4-bromophenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(1,3-benzodioxol-5-yl)-6-(4-bromophenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 5344235 |
| Molecular Formula | C21H12BrN3O2 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 2-amino-4-(1,3-benzodioxol-5-yl)-6-(4-bromophenyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccc(Br)cc2)cc(-c2ccc3c(c2)OCO3)c(C#N)c1N |
| InChI | InChI=1S/C21H12BrN3O2/c22-14-4-1-12(2-5-14)15-8-16(18(10-24)21(25)17(15)9-23)13-3-6-19-20(7-13)27-11-26-19/h1-8H,11,25H2 |
| InChIKey | ZUSVESOAAYODPO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|