C14H8BrNO3 — CID 167329048
3-(1,3-benzodioxol-5-yl)-5-bromo-4-hydroxybenzonitrile (PubChem CID 167329048) has the molecular formula C14H8BrNO3 and a molecular weight of 318.13 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-bromo-4-hydroxybenzonitrile.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-bromo-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 167329048 |
| Molecular Formula | C14H8BrNO3 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-bromo-4-hydroxybenzonitrile |
| SMILES | N#Cc1cc(Br)c(O)c(-c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C14H8BrNO3/c15-11-4-8(6-16)3-10(14(11)17)9-1-2-12-13(5-9)19-7-18-12/h1-5,17H,7H2 |
| InChIKey | LVUYYUKSCKGMHV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |