C15H12BrNO3 — CID 167329088
3-bromo-5-(3,5-dimethoxyphenyl)-4-hydroxybenzonitrile (PubChem CID 167329088) has the molecular formula C15H12BrNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is 3-bromo-5-(3,5-dimethoxyphenyl)-4-hydroxybenzonitrile.
| Compound Name | 3-bromo-5-(3,5-dimethoxyphenyl)-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 167329088 |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-bromo-5-(3,5-dimethoxyphenyl)-4-hydroxybenzonitrile |
| SMILES | COc1cc(OC)cc(-c2cc(C#N)cc(Br)c2O)c1 |
| InChI | InChI=1S/C15H12BrNO3/c1-19-11-5-10(6-12(7-11)20-2)13-3-9(8-17)4-14(16)15(13)18/h3-7,18H,1-2H3 |
| InChIKey | YCOYRLBHQSLTDN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |