C10H6N4O2 — CID 6411540
5-(1,3-benzodioxol-5-yl)-2H-triazole-4-carbonitrile (PubChem CID 6411540) has the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-2H-triazole-4-carbonitrile.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 6411540 |
| Molecular Formula | C10H6N4O2 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H6N4O2/c11-4-7-10(13-14-12-7)6-1-2-8-9(3-6)16-5-15-8/h1-3H,5H2,(H,12,13,14) |
| InChIKey | RDXWPRDPEMUJLE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |