C14H12O3 — CID 54078563
4-(1,3-benzodioxol-5-yl)-3-methylphenol (PubChem CID 54078563) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-methylphenol.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-methylphenol |
|---|---|
| PubChem CID | 54078563 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-methylphenol |
| SMILES | Cc1cc(O)ccc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12O3/c1-9-6-11(15)3-4-12(9)10-2-5-13-14(7-10)17-8-16-13/h2-7,15H,8H2,1H3 |
| InChIKey | UILDVZGLLKRWAG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |