C19H16O5 — CID 102203361
4-(1,3-benzodioxol-5-yl)-7,8-dimethoxynaphthalen-2-ol (PubChem CID 102203361) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-7,8-dimethoxynaphthalen-2-ol.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-7,8-dimethoxynaphthalen-2-ol |
|---|---|
| PubChem CID | 102203361 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-7,8-dimethoxynaphthalen-2-ol |
| SMILES | COc1ccc2c(-c3ccc4c(c3)OCO4)cc(O)cc2c1OC |
| InChI | InChI=1S/C19H16O5/c1-21-17-6-4-13-14(8-12(20)9-15(13)19(17)22-2)11-3-5-16-18(7-11)24-10-23-16/h3-9,20H,10H2,1-2H3 |
| InChIKey | VQAZXQQGBLEQDT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |