C33H30NO4+ — CID 66618791
3-(1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-4-[2-(4-phenylphenyl)ethyl]isoquinolin-2-ium (PubChem CID 66618791) has the molecular formula C33H30NO4+ and a molecular weight of 504.61 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-4-[2-(4-phenylphenyl)ethyl]isoquinolin-2-ium.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-4-[2-(4-phenylphenyl)ethyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 66618791 |
| Molecular Formula | C33H30NO4+ |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-4-[2-(4-phenylphenyl)ethyl]isoquinolin-2-ium |
| SMILES | COc1ccc2c(CCc3ccc(-c4ccccc4)cc3)c(-c3ccc4c(c3)OCO4)[n+](C)cc2c1OC |
| InChI | InChI=1S/C33H30NO4/c1-34-20-28-26(16-18-30(35-2)33(28)36-3)27(32(34)25-14-17-29-31(19-25)38-21-37-29)15-11-22-9-12-24(13-10-22)23-7-5-4-6-8-23/h4-10,12-14,16-20H,11,15,21H2,1-3H3/q+1 |
| InChIKey | AXGPRGSRXAOANM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|