C29H27ClNO5+ — CID 50898417
21-[2-[(4-chlorophenyl)methoxy]ethyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 50898417) has the molecular formula C29H27ClNO5+ and a molecular weight of 504.99 g/mol. Its IUPAC name is 21-[2-[(4-chlorophenyl)methoxy]ethyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 21-[2-[(4-chlorophenyl)methoxy]ethyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 50898417 |
| Molecular Formula | C29H27ClNO5+ |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 21-[2-[(4-chlorophenyl)methoxy]ethyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | COc1ccc2c(CCOCc3ccc(Cl)cc3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C29H27ClNO5/c1-32-25-8-7-21-22(10-12-34-16-18-3-5-20(30)6-4-18)28-23-14-27-26(35-17-36-27)13-19(23)9-11-31(28)15-24(21)29(25)33-2/h3-8,13-15H,9-12,16-17H2,1-2H3/q+1 |
| InChIKey | JJMJPWFOGQYIEY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|