C30H31N2O5+ — CID 50899796
4-[(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)methoxymethyl]-N,N-dimethylaniline (PubChem CID 50899796) has the molecular formula C30H31N2O5+ and a molecular weight of 499.59 g/mol. Its IUPAC name is 4-[(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)methoxymethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)methoxymethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 50899796 |
| Molecular Formula | C30H31N2O5+ |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 4-[(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)methoxymethyl]-N,N-dimethylaniline |
| SMILES | COc1ccc2c(COCc3ccc(N(C)C)cc3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C30H31N2O5/c1-31(2)21-7-5-19(6-8-21)16-35-17-25-22-9-10-26(33-3)30(34-4)24(22)15-32-12-11-20-13-27-28(37-18-36-27)14-23(20)29(25)32/h5-10,13-15H,11-12,16-18H2,1-4H3/q+1 |
| InChIKey | IRMGWSLJXRWWOB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|