C23H22NO6+ — CID 10206519
methyl 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)acetate (PubChem CID 10206519) has the molecular formula C23H22NO6+ and a molecular weight of 408.43 g/mol. Its IUPAC name is methyl 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)acetate.
| Compound Name | methyl 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)acetate |
|---|---|
| PubChem CID | 10206519 |
| Molecular Formula | C23H22NO6+ |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | methyl 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)acetate |
| SMILES | COC(=O)Cc1c2[n+](cc3c(OC)c(OC)ccc13)CCc1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C23H22NO6/c1-26-18-5-4-14-16(10-21(25)27-2)22-15-9-20-19(29-12-30-20)8-13(15)6-7-24(22)11-17(14)23(18)28-3/h4-5,8-9,11H,6-7,10,12H2,1-3H3/q+1 |
| InChIKey | UELNGKZXVCPFFO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|