C33H34NO5+ — CID 52940709
[17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl] butanoate (PubChem CID 52940709) has the molecular formula C33H34NO5+ and a molecular weight of 524.64 g/mol. Its IUPAC name is [17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl] butanoate.
| Compound Name | [17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl] butanoate |
|---|---|
| PubChem CID | 52940709 |
| Molecular Formula | C33H34NO5+ |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl] butanoate |
| SMILES | CCCC(=O)Oc1c(OC)ccc2c(Cc3ccc(C(C)C)cc3)c3[n+](cc12)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C33H34NO5/c1-5-6-31(35)39-33-27-18-34-14-13-23-16-29-30(38-19-37-29)17-25(23)32(34)26(24(27)11-12-28(33)36-4)15-21-7-9-22(10-8-21)20(2)3/h7-12,16-18,20H,5-6,13-15,19H2,1-4H3/q+1 |
| InChIKey | YYQCPOIJAZVFCU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|