C36H48ClNO5 — CID 71529289
(17-methoxy-21-nonyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) octanoate chloride (PubChem CID 71529289) has the molecular formula C36H48ClNO5 and a molecular weight of 610.24 g/mol. Its IUPAC name is (17-methoxy-21-nonyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) octanoate chloride.
| Compound Name | (17-methoxy-21-nonyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) octanoate chloride |
|---|---|
| PubChem CID | 71529289 |
| Molecular Formula | C36H48ClNO5 |
| Molecular Weight | 610.24 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | (17-methoxy-21-nonyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) octanoate chloride |
| SMILES | CCCCCCCCCc1c2[n+](cc3c(OC(=O)CCCCCCC)c(OC)ccc13)CCc1cc3c(cc1-2)OCO3.[Cl-] |
| InChI | InChI=1S/C36H48NO5.ClH/c1-4-6-8-10-11-13-14-16-28-27-18-19-31(39-3)36(42-34(38)17-15-12-9-7-5-2)30(27)24-37-21-20-26-22-32-33(41-25-40-32)23-29(26)35(28)37;/h18-19,22-24H,4-17,20-21,25H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UOAHVVDIAHLWGF-UHFFFAOYSA-M |
| XLogP | 5.65 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.24 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|