C31H42ClNO4 — CID 71529230
3,9-diethoxy-10-methoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol chloride (PubChem CID 71529230) has the molecular formula C31H42ClNO4 and a molecular weight of 528.13 g/mol. Its IUPAC name is 3,9-diethoxy-10-methoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol chloride.
| Compound Name | 3,9-diethoxy-10-methoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol chloride |
|---|---|
| PubChem CID | 71529230 |
| Molecular Formula | C31H42ClNO4 |
| Molecular Weight | 528.13 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 3,9-diethoxy-10-methoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol chloride |
| SMILES | CCCCCCCCCc1c2[n+](cc3c(OCC)c(OC)ccc13)CCc1cc(OCC)c(O)cc1-2.[Cl-] |
| InChI | InChI=1S/C31H41NO4.ClH/c1-5-8-9-10-11-12-13-14-24-23-15-16-28(34-4)31(36-7-3)26(23)21-32-18-17-22-19-29(35-6-2)27(33)20-25(22)30(24)32;/h15-16,19-21H,5-14,17-18H2,1-4H3;1H |
| InChIKey | PCCIKNJETXWENC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.13 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|