C30H31N2O6+ — CID 44572073
13-ethyl-2,3,10-trimethoxy-9-[(5-methyl-2-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 44572073) has the molecular formula C30H31N2O6+ and a molecular weight of 515.59 g/mol. Its IUPAC name is 13-ethyl-2,3,10-trimethoxy-9-[(5-methyl-2-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 13-ethyl-2,3,10-trimethoxy-9-[(5-methyl-2-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 44572073 |
| Molecular Formula | C30H31N2O6+ |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 13-ethyl-2,3,10-trimethoxy-9-[(5-methyl-2-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | CCc1c2[n+](cc3c(OCc4cc(C)ccc4[N+](=O)[O-])c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2 |
| InChI | InChI=1S/C30H31N2O6/c1-6-21-22-8-10-26(35-3)30(38-17-20-13-18(2)7-9-25(20)32(33)34)24(22)16-31-12-11-19-14-27(36-4)28(37-5)15-23(19)29(21)31/h7-10,13-16H,6,11-12,17H2,1-5H3/q+1 |
| InChIKey | IZNGBFSPGKWCST-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 83.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|