C22H22NO5+ — CID 101495556
2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carbaldehyde (PubChem CID 101495556) has the molecular formula C22H22NO5+ and a molecular weight of 380.42 g/mol. Its IUPAC name is 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carbaldehyde.
| Compound Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carbaldehyde |
|---|---|
| PubChem CID | 101495556 |
| Molecular Formula | C22H22NO5+ |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)-c1c(C=O)c3ccc(OC)c(OC)c3c[n+]1CC2 |
| InChI | InChI=1S/C22H22NO5/c1-25-18-6-5-14-16(22(18)28-4)11-23-8-7-13-9-19(26-2)20(27-3)10-15(13)21(23)17(14)12-24/h5-6,9-12H,7-8H2,1-4H3/q+1 |
| InChIKey | WFEXRPCMUYQTDM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|