C22H24NO4+ — CID 71453339
2-ethoxy-3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 71453339) has the molecular formula C22H24NO4+ and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-ethoxy-3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 2-ethoxy-3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 71453339 |
| Molecular Formula | C22H24NO4+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-ethoxy-3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | CCOc1cc2c(cc1OC)CC[n+]1cc3c(OC)c(OC)ccc3cc1-2 |
| InChI | InChI=1S/C22H24NO4/c1-5-27-21-12-16-15(11-20(21)25-3)8-9-23-13-17-14(10-18(16)23)6-7-19(24-2)22(17)26-4/h6-7,10-13H,5,8-9H2,1-4H3/q+1 |
| InChIKey | FJTOHAVQIXFCON-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|