C26H30NO9+ — CID 102128788
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl)oxy]oxane-3,4,5-triol (PubChem CID 102128788) has the molecular formula C26H30NO9+ and a molecular weight of 500.52 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl)oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl)oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102128788 |
| Molecular Formula | C26H30NO9+ |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl)oxy]oxane-3,4,5-triol |
| SMILES | COc1cc2c(cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CC[n+]1cc3c(OC)c(OC)ccc3cc1-2 |
| InChI | InChI=1S/C26H30NO9/c1-32-18-5-4-13-8-17-15-10-19(33-2)20(35-26-24(31)23(30)22(29)21(12-28)36-26)9-14(15)6-7-27(17)11-16(13)25(18)34-3/h4-5,8-11,21-24,26,28-31H,6-7,12H2,1-3H3/q+1/t21-,22-,23+,24-,26-/m1/s1 |
| InChIKey | AWLXIYPATXUIQC-HROMDODWSA-N |
| XLogP | 0.55 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|