C28H35N2O5+ — CID 166038485
1-[3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propyl]piperidin-4-ol (PubChem CID 166038485) has the molecular formula C28H35N2O5+ and a molecular weight of 479.60 g/mol. Its IUPAC name is 1-[3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 166038485 |
| Molecular Formula | C28H35N2O5+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 1-[3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propyl]piperidin-4-ol |
| SMILES | COc1cc2c(cc1OCCCN1CCC(O)CC1)-c1cc3ccc(OC)c(OC)c3c[n+]1CC2 |
| InChI | InChI=1S/C28H35N2O5/c1-32-25-6-5-19-15-24-22-17-27(35-14-4-10-29-11-8-21(31)9-12-29)26(33-2)16-20(22)7-13-30(24)18-23(19)28(25)34-3/h5-6,15-18,21,31H,4,7-14H2,1-3H3/q+1 |
| InChIKey | UFYKOVNEKLTBIG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|