C20H20NO7S+ — CID 102128784
(2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl) hydrogen sulfate (PubChem CID 102128784) has the molecular formula C20H20NO7S+ and a molecular weight of 418.45 g/mol. Its IUPAC name is (2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl) hydrogen sulfate.
| Compound Name | (2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 102128784 |
| Molecular Formula | C20H20NO7S+ |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-yl) hydrogen sulfate |
| SMILES | COc1cc2c(cc1OS(=O)(=O)O)CC[n+]1cc3c(OC)c(OC)ccc3cc1-2 |
| InChI | InChI=1S/C20H19NO7S/c1-25-17-5-4-12-8-16-14-10-18(26-2)19(28-29(22,23)24)9-13(14)6-7-21(16)11-15(12)20(17)27-3/h4-5,8-11H,6-7H2,1-3H3/p+1 |
| InChIKey | XRANVZBXCJWJNA-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|