C23H22NO8+ — CID 85469705
(Z)-but-2-enedioic acid;9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol (PubChem CID 85469705) has the molecular formula C23H22NO8+ and a molecular weight of 440.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol.
| Compound Name | (Z)-but-2-enedioic acid;9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol |
|---|---|
| PubChem CID | 85469705 |
| Molecular Formula | C23H22NO8+ |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (Z)-but-2-enedioic acid;9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1cc(O)c(O)cc1-3.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H17NO4.C4H4O4/c1-23-18-4-3-11-7-15-13-9-17(22)16(21)8-12(13)5-6-20(15)10-14(11)19(18)24-2;5-3(6)1-2-4(7)8/h3-4,7-10,22H,5-6H2,1-2H3;1-2H,(H,5,6)(H,7,8)/p+1/b;2-1- |
| InChIKey | RUWAPZNLXBYSPM-BTJKTKAUSA-O |
| XLogP | 2.49 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|