C22H24NO5+ — CID 166038519
2-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]ethanol (PubChem CID 166038519) has the molecular formula C22H24NO5+ and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]ethanol.
| Compound Name | 2-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]ethanol |
|---|---|
| PubChem CID | 166038519 |
| Molecular Formula | C22H24NO5+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]ethanol |
| SMILES | COc1cc2c(cc1OCCO)-c1cc3ccc(OC)c(OC)c3c[n+]1CC2 |
| InChI | InChI=1S/C22H24NO5/c1-25-19-5-4-14-10-18-16-12-21(28-9-8-24)20(26-2)11-15(16)6-7-23(18)13-17(14)22(19)27-3/h4-5,10-13,24H,6-9H2,1-3H3/q+1 |
| InChIKey | WAGJHKAGGVVRSC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|