C23H26NO5+ — CID 166038549
3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propan-1-ol (PubChem CID 166038549) has the molecular formula C23H26NO5+ and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propan-1-ol.
| Compound Name | 3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propan-1-ol |
|---|---|
| PubChem CID | 166038549 |
| Molecular Formula | C23H26NO5+ |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[(3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-yl)oxy]propan-1-ol |
| SMILES | COc1cc2c(cc1OCCCO)-c1cc3ccc(OC)c(OC)c3c[n+]1CC2 |
| InChI | InChI=1S/C23H26NO5/c1-26-20-6-5-15-11-19-17-13-22(29-10-4-9-25)21(27-2)12-16(17)7-8-24(19)14-18(15)23(20)28-3/h5-6,11-14,25H,4,7-10H2,1-3H3/q+1 |
| InChIKey | YSNJZPFEFKLYAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|