C19H18NO3+ — CID 169054619
9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol (PubChem CID 169054619) has the molecular formula C19H18NO3+ and a molecular weight of 308.36 g/mol. Its IUPAC name is 9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol.
| Compound Name | 9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol |
|---|---|
| PubChem CID | 169054619 |
| Molecular Formula | C19H18NO3+ |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1ccc(O)cc1-3 |
| InChI | InChI=1S/C19H17NO3/c1-22-18-6-4-13-9-17-15-10-14(21)5-3-12(15)7-8-20(17)11-16(13)19(18)23-2/h3-6,9-11H,7-8H2,1-2H3/p+1 |
| InChIKey | JRFGAMCHHNANFI-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|