C19H19N2O7+ — CID 90466220
9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol;nitric acid (PubChem CID 90466220) has the molecular formula C19H19N2O7+ and a molecular weight of 387.37 g/mol. Its IUPAC name is 9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol;nitric acid.
| Compound Name | 9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol;nitric acid |
|---|---|
| PubChem CID | 90466220 |
| Molecular Formula | C19H19N2O7+ |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3-diol;nitric acid |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1cc(O)c(O)cc1-3.O=[N+]([O-])O |
| InChI | InChI=1S/C19H17NO4.HNO3/c1-23-18-4-3-11-7-15-13-9-17(22)16(21)8-12(13)5-6-20(15)10-14(11)19(18)24-2;2-1(3)4/h3-4,7-10,22H,5-6H2,1-2H3;(H,2,3,4)/p+1 |
| InChIKey | HYZBICMCDIKTHL-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|