C30H40NO4+ — CID 71529237
2,3,9,10-tetramethoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 71529237) has the molecular formula C30H40NO4+ and a molecular weight of 478.65 g/mol. Its IUPAC name is 2,3,9,10-tetramethoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 2,3,9,10-tetramethoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 71529237 |
| Molecular Formula | C30H40NO4+ |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 2,3,9,10-tetramethoxy-13-nonyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | CCCCCCCCCc1c2[n+](cc3c(OC)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2 |
| InChI | InChI=1S/C30H40NO4/c1-6-7-8-9-10-11-12-13-23-22-14-15-26(32-2)30(35-5)25(22)20-31-17-16-21-18-27(33-3)28(34-4)19-24(21)29(23)31/h14-15,18-20H,6-13,16-17H2,1-5H3/q+1 |
| InChIKey | SNPJIGOGARWEBI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|