C33H38INO4 — CID 44572127
9-[(4-tert-butylphenyl)methoxy]-13-ethyl-2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide (PubChem CID 44572127) has the molecular formula C33H38INO4 and a molecular weight of 639.57 g/mol. Its IUPAC name is 9-[(4-tert-butylphenyl)methoxy]-13-ethyl-2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide.
| Compound Name | 9-[(4-tert-butylphenyl)methoxy]-13-ethyl-2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
|---|---|
| PubChem CID | 44572127 |
| Molecular Formula | C33H38INO4 |
| Molecular Weight | 639.57 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | 9-[(4-tert-butylphenyl)methoxy]-13-ethyl-2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
| SMILES | CCc1c2[n+](cc3c(OCc4ccc(C(C)(C)C)cc4)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2.[I-] |
| InChI | InChI=1S/C33H38NO4.HI/c1-8-24-25-13-14-28(35-5)32(38-20-21-9-11-23(12-10-21)33(2,3)4)27(25)19-34-16-15-22-17-29(36-6)30(37-7)18-26(22)31(24)34;/h9-14,17-19H,8,15-16,20H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | ACYSRIHIECPKOX-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|