C30H31IN2O6 — CID 44572022
13-ethyl-2,3,10-trimethoxy-9-[(2-methyl-3-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide (PubChem CID 44572022) has the molecular formula C30H31IN2O6 and a molecular weight of 642.49 g/mol. Its IUPAC name is 13-ethyl-2,3,10-trimethoxy-9-[(2-methyl-3-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide.
| Compound Name | 13-ethyl-2,3,10-trimethoxy-9-[(2-methyl-3-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
|---|---|
| PubChem CID | 44572022 |
| Molecular Formula | C30H31IN2O6 |
| Molecular Weight | 642.49 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | 13-ethyl-2,3,10-trimethoxy-9-[(2-methyl-3-nitrophenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
| SMILES | CCc1c2[n+](cc3c(OCc4cccc([N+](=O)[O-])c4C)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2.[I-] |
| InChI | InChI=1S/C30H31N2O6.HI/c1-6-21-22-10-11-26(35-3)30(38-17-20-8-7-9-25(18(20)2)32(33)34)24(22)16-31-13-12-19-14-27(36-4)28(37-5)15-23(19)29(21)31;/h7-11,14-16H,6,12-13,17H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | RYZNSWWWYHGEGQ-UHFFFAOYSA-M |
| XLogP | 2.74 |
| TPSA | 83.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|