C31H30NO6+ — CID 50898818
ethyl 4-[2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)ethyl]benzoate (PubChem CID 50898818) has the molecular formula C31H30NO6+ and a molecular weight of 512.58 g/mol. Its IUPAC name is ethyl 4-[2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)ethyl]benzoate.
| Compound Name | ethyl 4-[2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 50898818 |
| Molecular Formula | C31H30NO6+ |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | ethyl 4-[2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCc2c3[n+](cc4c(OC)c(OC)ccc24)CCc2cc4c(cc2-3)OCO4)cc1 |
| InChI | InChI=1S/C31H30NO6/c1-4-36-31(33)20-8-5-19(6-9-20)7-10-23-22-11-12-26(34-2)30(35-3)25(22)17-32-14-13-21-15-27-28(38-18-37-27)16-24(21)29(23)32/h5-6,8-9,11-12,15-17H,4,7,10,13-14,18H2,1-3H3/q+1 |
| InChIKey | CGFDYBUFDJRXTP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|