C31H29N2O4+ — CID 66842462
21-[3-(1H-indol-2-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 66842462) has the molecular formula C31H29N2O4+ and a molecular weight of 493.58 g/mol. Its IUPAC name is 21-[3-(1H-indol-2-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 21-[3-(1H-indol-2-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 66842462 |
| Molecular Formula | C31H29N2O4+ |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 21-[3-(1H-indol-2-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | COc1ccc2c(CCCc3cc4ccccc4[nH]3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C31H29N2O4/c1-34-27-11-10-22-23(8-5-7-21-14-20-6-3-4-9-26(20)32-21)30-24-16-29-28(36-18-37-29)15-19(24)12-13-33(30)17-25(22)31(27)35-2/h3-4,6,9-11,14-17,32H,5,7-8,12-13,18H2,1-2H3/q+1 |
| InChIKey | UCOVAGIYYPSBDC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|