C23H24NO4+ — CID 10429737
16-ethoxy-21-ethyl-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 10429737) has the molecular formula C23H24NO4+ and a molecular weight of 378.45 g/mol. Its IUPAC name is 16-ethoxy-21-ethyl-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 16-ethoxy-21-ethyl-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 10429737 |
| Molecular Formula | C23H24NO4+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 16-ethoxy-21-ethyl-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | CCOc1c(OC)ccc2c(CC)c3[n+](cc12)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C23H24NO4/c1-4-15-16-6-7-19(25-3)23(26-5-2)18(16)12-24-9-8-14-10-20-21(28-13-27-20)11-17(14)22(15)24/h6-7,10-12H,4-5,8-9,13H2,1-3H3/q+1 |
| InChIKey | ADIMMBVHMQNOAH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|