C27H22NO5+ — CID 3542629
(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-phenylmethanone (PubChem CID 3542629) has the molecular formula C27H22NO5+ and a molecular weight of 440.48 g/mol. Its IUPAC name is (16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-phenylmethanone.
| Compound Name | (16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-phenylmethanone |
|---|---|
| PubChem CID | 3542629 |
| Molecular Formula | C27H22NO5+ |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-phenylmethanone |
| SMILES | COc1ccc2c(C(=O)c3ccccc3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C27H22NO5/c1-30-21-9-8-18-20(27(21)31-2)14-28-11-10-17-12-22-23(33-15-32-22)13-19(17)25(28)24(18)26(29)16-6-4-3-5-7-16/h3-9,12-14H,10-11,15H2,1-2H3/q+1 |
| InChIKey | KGYMADNUODVWFC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|