C28H25N2O6+ — CID 66842478
2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-hydroxyphenyl)ethanone (PubChem CID 66842478) has the molecular formula C28H25N2O6+ and a molecular weight of 485.52 g/mol. Its IUPAC name is 2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-hydroxyphenyl)ethanone.
| Compound Name | 2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 66842478 |
| Molecular Formula | C28H25N2O6+ |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-hydroxyphenyl)ethanone |
| SMILES | COc1ccc2c(C(N)C(=O)c3ccc(O)cc3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C28H24N2O6/c1-33-21-8-7-18-20(28(21)34-2)13-30-10-9-16-11-22-23(36-14-35-22)12-19(16)26(30)24(18)25(29)27(32)15-3-5-17(31)6-4-15/h3-8,11-13,25H,9-10,14,29H2,1-2H3/p+1 |
| InChIKey | UMFIHAICXWGBLF-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|