C29H27IN2O6 — CID 66842687
2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-methoxyphenyl)ethanone iodide (PubChem CID 66842687) has the molecular formula C29H27IN2O6 and a molecular weight of 626.45 g/mol. Its IUPAC name is 2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-methoxyphenyl)ethanone iodide.
| Compound Name | 2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-methoxyphenyl)ethanone iodide |
|---|---|
| PubChem CID | 66842687 |
| Molecular Formula | C29H27IN2O6 |
| Molecular Weight | 626.45 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | 2-amino-2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-1-(4-methoxyphenyl)ethanone iodide |
| SMILES | COc1ccc(C(=O)C(N)c2c3[n+](cc4c(OC)c(OC)ccc24)CCc2cc4c(cc2-3)OCO4)cc1.[I-] |
| InChI | InChI=1S/C29H27N2O6.HI/c1-33-18-6-4-16(5-7-18)28(32)26(30)25-19-8-9-22(34-2)29(35-3)21(19)14-31-11-10-17-12-23-24(37-15-36-23)13-20(17)27(25)31;/h4-9,12-14,26H,10-11,15,30H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BCKUGVJDSUZIPP-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|