C29H27N2O6+ — CID 66842681
2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-2-(4-methoxyphenyl)acetamide (PubChem CID 66842681) has the molecular formula C29H27N2O6+ and a molecular weight of 499.54 g/mol. Its IUPAC name is 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 66842681 |
| Molecular Formula | C29H27N2O6+ |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-21-yl)-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(C(N)=O)c2c3[n+](cc4c(OC)c(OC)ccc24)CCc2cc4c(cc2-3)OCO4)cc1 |
| InChI | InChI=1S/C29H26N2O6/c1-33-18-6-4-16(5-7-18)25(29(30)32)26-19-8-9-22(34-2)28(35-3)21(19)14-31-11-10-17-12-23-24(37-15-36-23)13-20(17)27(26)31/h4-9,12-14,25H,10-11,15H2,1-3H3,(H-,30,32)/p+1 |
| InChIKey | DPKOTCHOLBXPKM-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|