C23H24ClNO6 — CID 10297353
2-(2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-yl)acetic acid chloride (PubChem CID 10297353) has the molecular formula C23H24ClNO6 and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-(2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-yl)acetic acid chloride.
| Compound Name | 2-(2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-yl)acetic acid chloride |
|---|---|
| PubChem CID | 10297353 |
| Molecular Formula | C23H24ClNO6 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-(2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-13-yl)acetic acid chloride |
| SMILES | COc1cc2c(cc1OC)-c1c(CC(=O)O)c3ccc(OC)c(OC)c3c[n+]1CC2.[Cl-] |
| InChI | InChI=1S/C23H23NO6.ClH/c1-27-18-6-5-14-16(11-21(25)26)22-15-10-20(29-3)19(28-2)9-13(15)7-8-24(22)12-17(14)23(18)30-4;/h5-6,9-10,12H,7-8,11H2,1-4H3;1H |
| InChIKey | WZZVMTJYYXBHAH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|