C31H26INO4 — CID 162319450
7-[3,4-dimethoxy-5-(4-phenylphenyl)phenyl]-5-methyl-[1,3]dioxolo[4,5-g]quinolin-5-ium iodide (PubChem CID 162319450) has the molecular formula C31H26INO4 and a molecular weight of 603.46 g/mol. Its IUPAC name is 7-[3,4-dimethoxy-5-(4-phenylphenyl)phenyl]-5-methyl-[1,3]dioxolo[4,5-g]quinolin-5-ium iodide.
| Compound Name | 7-[3,4-dimethoxy-5-(4-phenylphenyl)phenyl]-5-methyl-[1,3]dioxolo[4,5-g]quinolin-5-ium iodide |
|---|---|
| PubChem CID | 162319450 |
| Molecular Formula | C31H26INO4 |
| Molecular Weight | 603.46 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | 7-[3,4-dimethoxy-5-(4-phenylphenyl)phenyl]-5-methyl-[1,3]dioxolo[4,5-g]quinolin-5-ium iodide |
| SMILES | COc1cc(-c2cc3cc4c(cc3[n+](C)c2)OCO4)cc(-c2ccc(-c3ccccc3)cc2)c1OC.[I-] |
| InChI | InChI=1S/C31H26NO4.HI/c1-32-18-25(13-24-16-28-29(17-27(24)32)36-19-35-28)23-14-26(31(34-3)30(15-23)33-2)22-11-9-21(10-12-22)20-7-5-4-6-8-20;/h4-18H,19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UPUQGMAEQJCIDP-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|