C26H25FINO4 — CID 161293828
[3-[3-(4-fluorophenyl)-4,5-dimethoxyphenyl]-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol iodide (PubChem CID 161293828) has the molecular formula C26H25FINO4 and a molecular weight of 561.39 g/mol. Its IUPAC name is [3-[3-(4-fluorophenyl)-4,5-dimethoxyphenyl]-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol iodide.
| Compound Name | [3-[3-(4-fluorophenyl)-4,5-dimethoxyphenyl]-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol iodide |
|---|---|
| PubChem CID | 161293828 |
| Molecular Formula | C26H25FINO4 |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | [3-[3-(4-fluorophenyl)-4,5-dimethoxyphenyl]-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol iodide |
| SMILES | COc1cc(-c2cc3cc(CO)c(CO)cc3[n+](C)c2)cc(-c2ccc(F)cc2)c1OC.[I-] |
| InChI | InChI=1S/C26H25FNO4.HI/c1-28-13-19(8-18-9-20(14-29)21(15-30)11-24(18)28)17-10-23(16-4-6-22(27)7-5-16)26(32-3)25(12-17)31-2;/h4-13,29-30H,14-15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CRMZMYAYSZOMPD-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|