C20H19FN2O3 — CID 126673167
5-(4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine (PubChem CID 126673167) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine.
| Compound Name | 5-(4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126673167 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-(4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine |
| SMILES | COc1cc(-c2cc(-c3ccc(F)cc3)cnc2N)cc(OC)c1OC |
| InChI | InChI=1S/C20H19FN2O3/c1-24-17-9-13(10-18(25-2)19(17)26-3)16-8-14(11-23-20(16)22)12-4-6-15(21)7-5-12/h4-11H,1-3H3,(H2,22,23) |
| InChIKey | PDZIVXVNXDMVSU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |