C23H25N3O5 — CID 126672906
3-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-N-(2-hydroxyethyl)benzamide (PubChem CID 126672906) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 126672906 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-N-(2-hydroxyethyl)benzamide |
| SMILES | COc1cc(-c2cc(-c3cccc(C(=O)NCCO)c3)cnc2N)cc(OC)c1OC |
| InChI | InChI=1S/C23H25N3O5/c1-29-19-11-16(12-20(30-2)21(19)31-3)18-10-17(13-26-22(18)24)14-5-4-6-15(9-14)23(28)25-7-8-27/h4-6,9-13,27H,7-8H2,1-3H3,(H2,24,26)(H,25,28) |
| InChIKey | GOSDBKJGOCIDPO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |