C14H16N4O3 — CID 121004737
3-amino-N-(2-hydroxyethyl)-6-(3-methoxyphenyl)pyrazine-2-carboxamide (PubChem CID 121004737) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxyethyl)-6-(3-methoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(2-hydroxyethyl)-6-(3-methoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 121004737 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-amino-N-(2-hydroxyethyl)-6-(3-methoxyphenyl)pyrazine-2-carboxamide |
| SMILES | COc1cccc(-c2cnc(N)c(C(=O)NCCO)n2)c1 |
| InChI | InChI=1S/C14H16N4O3/c1-21-10-4-2-3-9(7-10)11-8-17-13(15)12(18-11)14(20)16-5-6-19/h2-4,7-8,19H,5-6H2,1H3,(H2,15,17)(H,16,20) |
| InChIKey | FMZVVUPAFLKWFJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |