C15H17N5O2 — CID 10402476
N-(2-acetamidoethyl)-3-amino-6-phenylpyrazine-2-carboxamide (PubChem CID 10402476) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-amino-6-phenylpyrazine-2-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-3-amino-6-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10402476 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-(2-acetamidoethyl)-3-amino-6-phenylpyrazine-2-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1nc(-c2ccccc2)cnc1N |
| InChI | InChI=1S/C15H17N5O2/c1-10(21)17-7-8-18-15(22)13-14(16)19-9-12(20-13)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,16,19)(H,17,21)(H,18,22) |
| InChIKey | KMGQRNALSGEZAE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|